Chemistry copper cu s 4hno3 aq cu no3 2 aq 2no2 g 2h2o l

chemistry copper cu s 4hno3 aq cu no3 2 aq 2no2 g 2h2o l Chemistry copper cu s 4hno3 aq cu no3 2 aq 2no2 g 2h2o l ap chemistry 12/13/11 round-trip copper reactions lab the purpose of this lab was to evaluate our skills of decanting a supernatant liquid without losing the solid and successful completion of a series of reactions this was done through five chemical reactions involving copper.

Best answer: cu(s) + 4hno3 (aq)-- cu(no3)2(aq) + 2h2o(l) +2no2(g) cu no3 2 this site might help you re: balancing equation cu+hno3--->cu(no3)2+h2o+no2 cu+hno3--->cu(no3)2+h2o+no2 on left you have 1 cu, on right you have 1 cu - good on left you have 1 h, on right you. Calculating the mass of zinc required to reduce copper high school chemistry forum calculating the mass of zinc required to reduce copper cu(s)+4hno3(aq)=cu(no3)2(aq)+2no2(g)+2h2o(l) #2 cu(no3)2(aq)+2naoh(aq)=cu(oh)2(s)+2nano3(aq) #3. Similar questions chemistry given the following chemical equation: 3 +cu +8 hno3 = 3 cu(no3)2 + 2 no + 4 h2o 1)how many moles of cu(no3)2 are produced when 3 moles of cu react. So i know the equation looks something like this cu (s) + hno3 (aq) ---- cu(no3)2 (aq) + no2 (g) + h2o (l) and i know its a redox reaction with copper the reducing agent and nitrogen the oxidizing agent but i'm having trouble balancing/setting up the half reactions any help would be greatly show more so i know the equation looks something. Science & mathematics chemistry next balancing equation cu+hno3---cu(no3)2+h2o+no2 when it reacts with o2 it turns to the brick red no2 that we observe when copper metal reacts with nitric + 4hno3(aq) -- cu(no3)2(aq) + 2h2o(l) + 2no2(g) source(s): pisgahchemist 4. Redox, double displacement, single displacement, etc i'm just not sure how to classify this i don't want to know just what type of reaction it is, but why as well so i understand thanks.

How to balance this redox reaction (using half reaction method):$$\ce{cu + hno3 - cu(no3)2 + no + no2}$$ you really can't balance this equation for two reasons. (s) + 4hno3(aq)---cu(no3)2 (aq) + 2no2(g) +2h2o (l) 2 cu(no3)2 (aq redox 1 cu(s) + 4hno3(aq)---cu(no3)2 (aq) + 2no2(g) +2h2o (l) 2 cu(no3)2 (aq cuso4(aq) + zn(s)---cu(s) + znso4(aq) 5 cuo(s) + 2h^+ (aq)----cu^2+ (aq) + h2o show more identify the reaction. Experiment 28 - chemistry of copper objective the objectives of this experiment include observing copper's chemical properties throughout several chemical reactions red solid - brown gas + blue solution balanced equation: cu(s) + 4hno3(aq) - cu(no3)2(aq)+2no2(g) + 2h2o(l) b cu(oh)2. So i know the equation looks something like this cu (s) + hno3 (aq) ---- cu(no3)2 (aq) + no2 (g) + h2o (l) and i know its a redox reaction with copper the reducing agent and nitrogen the oxidizing agent but i'm having trouble balancing/setting up the half reactions any help would be greatly appreciated.

And copper(ii) nitrate, cu(no_3)_2 (aq]) + cu(no_3)_text(2(aq]) - cu(oh)_text(2(s]) darr + 2nano_text(3(aq]) now, notice that you need 2 moles of sodium hydroxide for every 1 mole of copper socratic meta ask question log in sign up chemistry science. There are two copper blocks sitting in the $\ce{cu(no3)2 (aq)}$ solution, a battery is attached onto both of them, providing enough energy to start the reaction since solid pieces of copper are. What happens with copper depends entirely on the hno3 concentration cu + 4hno3 --- cu(no3)2 + 2no2(g) + 2h2o alternatively, in net ionic form cu(s) + 4h+(aq) + 2no3-(aq) ---- cu2+(aq) + 2no2(g) + 2h2o [nitrate ions appearing both sides have been cancelled out] with 50% hno3 you get 3cu. Get an answer for 'when conc nitric acid is allowed to react with copper,what is the color change of the resulting solution and the ion responsible for this change' and find homework help for other chemistry (aq) —— cu(no3)2(aq) + 2no2(g) + 2h2o(l) (no3) 2 + 2no + 4hno3 2no + o2.

Balancing redox equations strategy for redox equations in acidic solutions problem: when dilute nitric acid is poured on a piece of copper metal, copper(ii) ions 0 +1 +5 2 +2 +2 2 cu(s)+h+(aq)+no 3 (aq) cu2+(aq)+no(g) so we have cu : 0 +2 ox n. Replace g of cu to moles of cu (use the atomic mass of copper) from the balanced equation you get the mole ratio between copper and no2 (a million:2) so double the moles of copper to get moles of no2 replace moles of no2 to liters of no2 by remembering a million mole of gas occupies 224 l at stp so multiply the moles of no2 by 224 l.

Chemistry copper cu s 4hno3 aq cu no3 2 aq 2no2 g 2h2o l

Transformation of copper: a sequence of chemical reactions objectives reactions procedure objectives illustrate variety of substances of which an element can be part. How can l prepare cu(oh)2 update cancel answer wiki 4 answers lucas curtis (s) + 4hno3(aq) → cu(no3)2 + 2no2(g) + 2h2o(l) besides that, the reactant required to prepare cu(oh)2 were include, copper (ii) solution, ammonia solution and water ammonia react with metallic ions except.

What mass of cu metal is required to react with 43 drops of 16m hno3 assume 20 drops = 1 ml cu (mm 6354 g/mol), (16m = 16 mol/l. Use this calculator to balance chemistry equations = sno2(s) + 4no2(g) + 2h2o(l) sn + agno3 = sn(no3)2+ag: sn + 2agno3 = sn(no3)2 + 2ag: sc2o3(s)+so3(l)= sc2(so4)3(s) sc2o3(s) + 3so3(l) = sc2(so4)3(s) s2cl2+h2o=hcl (s) + 4hno3(aq) = sno2(s) + 4no2(g) + 2h2o(l) so2+o2=so3: 2so2 + o2. Hi, i need help putting the following into a net ionic equation: cu(s) + 4hno3(aq) → cu(no3)2(aq) + 2no2(g) + 2h2o(l) i am not sure how to do subscripts on this forum. + 4hno3(aq) - cu(no3)2(aq) + 2no2(g) + 2h2o(l) cu(s) + 4h+ + 4no3- - cu2+ + 2no3- + 2no2(g) the copper lab demonstrates stoichiometry in chemistry (l) the copper compound, cuo(s), reacted with h2so4(aq) to form cu2. Cu + hno 3 - the solution became blue all of the copper in precipitate form has been removed nitrogen gas was formed cu(no3)2 - naoh - a blue precipitate was formed. Solid copper is reacting with nitric acid, becoming a blue solution of aqueous cupric nitrate and h2o, and a brown, poisonous gas: nitrogen oxide. Chemistry copper is changed to copper(ii) ions by nitric acid according to the following equation: 4hno3 + cu → cu(no3)2 + 2no2 + 2h2o how many moles of hno3 must react to produce 0961 mol of no2.

Best answer: hno3 is nitric acid, and cu(s) is copper which is a metal but if you're asking what forms when you add the two together metal + acid --- salt + hydrogen gas (or water, depending on the acid used. I have a chem lab due and it gives the following reaction cu(s)+4hno3(aq)-cu(no3)2 (aq)+2no2(g)+2h2o(l. Lab report 7 uploaded by bhumi patel connect to download /2 the purpose of this experiment is to observe the chemistry of copper cycle in aqueous solution done through 5 chemical reaction and to /5 cu(s) + 4hno3(aq) → cu(no3)2(aq) + 2no2(g) + 2h2o(l) copper nitric acid. (aq) cu(no3)2 (aq) + no2 (g) + h2o (l) b cu(no3)2 (aq) + naoh (aq) cu(oh)2 (s) + nano3 (aq) c cu(oh)2 (s) chemical transformations of copper 1 + 4hno3 (aq) cu(no3)2 (aq) + 2no2 (g) + 2h2o.

chemistry copper cu s 4hno3 aq cu no3 2 aq 2no2 g 2h2o l Chemistry copper cu s 4hno3 aq cu no3 2 aq 2no2 g 2h2o l ap chemistry 12/13/11 round-trip copper reactions lab the purpose of this lab was to evaluate our skills of decanting a supernatant liquid without losing the solid and successful completion of a series of reactions this was done through five chemical reactions involving copper. chemistry copper cu s 4hno3 aq cu no3 2 aq 2no2 g 2h2o l Chemistry copper cu s 4hno3 aq cu no3 2 aq 2no2 g 2h2o l ap chemistry 12/13/11 round-trip copper reactions lab the purpose of this lab was to evaluate our skills of decanting a supernatant liquid without losing the solid and successful completion of a series of reactions this was done through five chemical reactions involving copper.
Chemistry copper cu s 4hno3 aq cu no3 2 aq 2no2 g 2h2o l
Rated 4/5 based on 41 review